C33H27ClN2O5 — CID 4150887
8-(3-chlorophenyl)-6-(4-hydroxy-3-methylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4150887) has the molecular formula C33H27ClN2O5 and a molecular weight of 567.04 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-6-(4-hydroxy-3-methylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-6-(4-hydroxy-3-methylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4150887 |
| Molecular Formula | C33H27ClN2O5 |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 8-(3-chlorophenyl)-6-(4-hydroxy-3-methylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cc(C2C3=CCC4C(=O)NC(=O)C4C3CC3C(=O)N(c4cccc(Cl)c4)C(=O)C32c2ccccc2)ccc1O |
| InChI | InChI=1S/C33H27ClN2O5/c1-17-14-18(10-13-26(17)37)28-22-11-12-23-27(30(39)35-29(23)38)24(22)16-25-31(40)36(21-9-5-8-20(34)15-21)32(41)33(25,28)19-6-3-2-4-7-19/h2-11,13-15,23-25,27-28,37H,12,16H2,1H3,(H,35,38,39) |
| InChIKey | HOYYFQBZXFMSBO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|