C32H25ClN2O5 — CID 4998294
8-(3-chlorophenyl)-6-(4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4998294) has the molecular formula C32H25ClN2O5 and a molecular weight of 553.01 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-6-(4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-6-(4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4998294 |
| Molecular Formula | C32H25ClN2O5 |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 8-(3-chlorophenyl)-6-(4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1NC(=O)C2C1CC=C1C2CC2C(=O)N(c3cccc(Cl)c3)C(=O)C2(c2ccccc2)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C32H25ClN2O5/c33-19-7-4-8-20(15-19)35-30(39)25-16-24-22(13-14-23-26(24)29(38)34-28(23)37)27(17-9-11-21(36)12-10-17)32(25,31(35)40)18-5-2-1-3-6-18/h1-13,15,23-27,36H,14,16H2,(H,34,37,38) |
| InChIKey | NXNGMRXSHSFXKL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|