C36H33ClN2O5 — CID 4998284
2-tert-butyl-8-(3-chlorophenyl)-6-(4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4998284) has the molecular formula C36H33ClN2O5 and a molecular weight of 609.12 g/mol. Its IUPAC name is 2-tert-butyl-8-(3-chlorophenyl)-6-(4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-tert-butyl-8-(3-chlorophenyl)-6-(4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4998284 |
| Molecular Formula | C36H33ClN2O5 |
| Molecular Weight | 609.12 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | 2-tert-butyl-8-(3-chlorophenyl)-6-(4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC(C)(C)N1C(=O)C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3ccc(O)cc3)C2C1=O |
| InChI | InChI=1S/C36H33ClN2O5/c1-35(2,3)39-31(41)26-17-16-25-27(29(26)33(39)43)19-28-32(42)38(23-11-7-10-22(37)18-23)34(44)36(28,21-8-5-4-6-9-21)30(25)20-12-14-24(40)15-13-20/h4-16,18,26-30,40H,17,19H2,1-3H3 |
| InChIKey | FPDHCKIOKDWHHG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.12 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|