C43H33ClN4O6 — CID 5197046
13-(3-chlorophenyl)-10-(2-hydroxy-4-phenylmethoxyphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 5197046) has the molecular formula C43H33ClN4O6 and a molecular weight of 737.21 g/mol. Its IUPAC name is 13-(3-chlorophenyl)-10-(2-hydroxy-4-phenylmethoxyphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 13-(3-chlorophenyl)-10-(2-hydroxy-4-phenylmethoxyphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 5197046 |
| Molecular Formula | C43H33ClN4O6 |
| Molecular Weight | 737.21 g/mol |
| Exact Mass | 736.21 |
| IUPAC Name | 13-(3-chlorophenyl)-10-(2-hydroxy-4-phenylmethoxyphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | O=C1C2CC3C(=CCn4c(=O)n(-c5ccccc5)c(=O)n43)C(c3ccc(OCc4ccccc4)cc3O)C2(c2ccccc2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C43H33ClN4O6/c44-29-15-10-18-31(23-29)46-39(50)35-25-36-33(21-22-45-41(52)47(42(53)48(36)45)30-16-8-3-9-17-30)38(43(35,40(46)51)28-13-6-2-7-14-28)34-20-19-32(24-37(34)49)54-26-27-11-4-1-5-12-27/h1-21,23-24,35-36,38,49H,22,25-26H2 |
| InChIKey | XSYHUAGEMUFLDT-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.21 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|