C39H35N5O6 — CID 6640184
(1R,10R,11S,15R)-10-(2-hydroxy-4-phenylmethoxyphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6640184) has the molecular formula C39H35N5O6 and a molecular weight of 669.74 g/mol. Its IUPAC name is (1R,10R,11S,15R)-10-(2-hydroxy-4-phenylmethoxyphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10R,11S,15R)-10-(2-hydroxy-4-phenylmethoxyphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6640184 |
| Molecular Formula | C39H35N5O6 |
| Molecular Weight | 669.74 g/mol |
| Exact Mass | 669.26 |
| IUPAC Name | (1R,10R,11S,15R)-10-(2-hydroxy-4-phenylmethoxyphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | Cc1ccc(NN2C(=O)[C@@H]3C[C@@H]4C(=CCn5c(=O)n(C)c(=O)n54)[C@H](c4ccc(OCc5ccccc5)cc4O)[C@]3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C39H35N5O6/c1-24-13-15-27(16-14-24)40-43-35(46)31-22-32-29(19-20-42-37(48)41(2)38(49)44(32)42)34(39(31,36(43)47)26-11-7-4-8-12-26)30-18-17-28(21-33(30)45)50-23-25-9-5-3-6-10-25/h3-19,21,31-32,34,40,45H,20,22-23H2,1-2H3/t31-,32+,34+,39+/m0/s1 |
| InChIKey | ORKWRGDDSOFRCF-JQZXUTORSA-N |
| XLogP | 4.56 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.74 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|