C33H31N5O5 — CID 6640166
(1R,10R,11S,15R)-10-(2-hydroxy-3-methylphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6640166) has the molecular formula C33H31N5O5 and a molecular weight of 577.64 g/mol. Its IUPAC name is (1R,10R,11S,15R)-10-(2-hydroxy-3-methylphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10R,11S,15R)-10-(2-hydroxy-3-methylphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6640166 |
| Molecular Formula | C33H31N5O5 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | (1R,10R,11S,15R)-10-(2-hydroxy-3-methylphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | Cc1ccc(NN2C(=O)[C@@H]3C[C@@H]4C(=CCn5c(=O)n(C)c(=O)n54)[C@H](c4cccc(C)c4O)[C@]3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C33H31N5O5/c1-19-12-14-22(15-13-19)34-37-29(40)25-18-26-23(16-17-36-31(42)35(3)32(43)38(26)36)27(24-11-7-8-20(2)28(24)39)33(25,30(37)41)21-9-5-4-6-10-21/h4-16,25-27,34,39H,17-18H2,1-3H3/t25-,26+,27+,33+/m0/s1 |
| InChIKey | LVZPXVHNKZKLCY-ZJXZHUIYSA-N |
| XLogP | 3.29 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|