C32H28BrN5O5 — CID 6640142
(1R,10R,11S,15R)-10-(5-bromo-2-hydroxyphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6640142) has the molecular formula C32H28BrN5O5 and a molecular weight of 642.51 g/mol. Its IUPAC name is (1R,10R,11S,15R)-10-(5-bromo-2-hydroxyphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10R,11S,15R)-10-(5-bromo-2-hydroxyphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6640142 |
| Molecular Formula | C32H28BrN5O5 |
| Molecular Weight | 642.51 g/mol |
| Exact Mass | 641.13 |
| IUPAC Name | (1R,10R,11S,15R)-10-(5-bromo-2-hydroxyphenyl)-4-methyl-13-(4-methylanilino)-11-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | Cc1ccc(NN2C(=O)[C@@H]3C[C@@H]4C(=CCn5c(=O)n(C)c(=O)n54)[C@H](c4cc(Br)ccc4O)[C@]3(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C32H28BrN5O5/c1-18-8-11-21(12-9-18)34-37-28(40)24-17-25-22(14-15-36-30(42)35(2)31(43)38(25)36)27(23-16-20(33)10-13-26(23)39)32(24,29(37)41)19-6-4-3-5-7-19/h3-14,16,24-25,27,34,39H,15,17H2,1-2H3/t24-,25+,27+,32+/m0/s1 |
| InChIKey | SMRSLGVAZCPZEC-JGBVGIGOSA-N |
| XLogP | 3.74 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|