C28H21ClN6O5 — CID 4547994
10-(5-chloro-2-hydroxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 4547994) has the molecular formula C28H21ClN6O5 and a molecular weight of 556.97 g/mol. Its IUPAC name is 10-(5-chloro-2-hydroxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 10-(5-chloro-2-hydroxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 4547994 |
| Molecular Formula | C28H21ClN6O5 |
| Molecular Weight | 556.97 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 10-(5-chloro-2-hydroxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1CC=C1C2Cn2c(=O)n(-c3ccccc3)c(=O)n2C1c1cc(Cl)ccc1O |
| InChI | InChI=1S/C28H21ClN6O5/c29-17-11-12-23(36)21(15-17)24-20-13-14-30-25(37)32(18-7-3-1-4-8-18)27(39)34(30)22(20)16-31-26(38)33(28(40)35(24)31)19-9-5-2-6-10-19/h1-13,15,22,24,36H,14,16H2 |
| InChIKey | MGPBMLXZXITTAF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.97 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|