C32H24N6O5 — CID 3457931
10-(2-hydroxynaphthalen-1-yl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 3457931) has the molecular formula C32H24N6O5 and a molecular weight of 572.58 g/mol. Its IUPAC name is 10-(2-hydroxynaphthalen-1-yl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 10-(2-hydroxynaphthalen-1-yl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 3457931 |
| Molecular Formula | C32H24N6O5 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 10-(2-hydroxynaphthalen-1-yl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1CC=C1C2Cn2c(=O)n(-c3ccccc3)c(=O)n2C1c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C32H24N6O5/c39-26-16-15-20-9-7-8-14-23(20)27(26)28-24-17-18-33-29(40)35(21-10-3-1-4-11-21)31(42)37(33)25(24)19-34-30(41)36(32(43)38(28)34)22-12-5-2-6-13-22/h1-17,25,28,39H,18-19H2 |
| InChIKey | VAYYMYJSSVJERS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|