C30H19Cl4N3O5 — CID 4173453
3,5,6,8-tetrachloro-2-(4-hydroxynaphthalen-1-yl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 4173453) has the molecular formula C30H19Cl4N3O5 and a molecular weight of 643.31 g/mol. Its IUPAC name is 3,5,6,8-tetrachloro-2-(4-hydroxynaphthalen-1-yl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | 3,5,6,8-tetrachloro-2-(4-hydroxynaphthalen-1-yl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 4173453 |
| Molecular Formula | C30H19Cl4N3O5 |
| Molecular Weight | 643.31 g/mol |
| Exact Mass | 641.01 |
| IUPAC Name | 3,5,6,8-tetrachloro-2-(4-hydroxynaphthalen-1-yl)-13-phenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)C2(Cl)C(c3ccc(O)c4ccccc34)C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4C3CC12Cl |
| InChI | InChI=1S/C30H19Cl4N3O5/c31-23-24(32)26(40)30(34)22(18-10-11-21(38)17-9-5-4-8-16(17)18)19-12-13-35-27(41)36(15-6-2-1-3-7-15)28(42)37(35)20(19)14-29(30,33)25(23)39/h1-12,20,22,38H,13-14H2 |
| InChIKey | GZPYVIYVAMGIIV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.31 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|