C30H20Cl2F2N4O5 — CID 6639405
(1R,10R,11S,15R)-11,15-dichloro-10-(3-fluoro-2-hydroxyphenyl)-13-(4-fluorophenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6639405) has the molecular formula C30H20Cl2F2N4O5 and a molecular weight of 625.42 g/mol. Its IUPAC name is (1R,10R,11S,15R)-11,15-dichloro-10-(3-fluoro-2-hydroxyphenyl)-13-(4-fluorophenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10R,11S,15R)-11,15-dichloro-10-(3-fluoro-2-hydroxyphenyl)-13-(4-fluorophenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6639405 |
| Molecular Formula | C30H20Cl2F2N4O5 |
| Molecular Weight | 625.42 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | (1R,10R,11S,15R)-11,15-dichloro-10-(3-fluoro-2-hydroxyphenyl)-13-(4-fluorophenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | O=C1N(c2ccc(F)cc2)C(=O)[C@@]2(Cl)[C@@H](c3cccc(F)c3O)C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@@]12Cl |
| InChI | InChI=1S/C30H20Cl2F2N4O5/c31-29-15-22-19(13-14-35-27(42)37(28(43)38(22)35)17-5-2-1-3-6-17)23(20-7-4-8-21(34)24(20)39)30(29,32)26(41)36(25(29)40)18-11-9-16(33)10-12-18/h1-13,22-23,39H,14-15H2/t22-,23-,29-,30+/m1/s1 |
| InChIKey | SGSPHGWMMOIVIS-ALIATHRISA-N |
| XLogP | 3.98 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|