C34H23Cl2FN4O5 — CID 6639837
(1R,10R,11S,15R)-11,15-dichloro-13-(4-fluorophenyl)-10-(1-hydroxynaphthalen-2-yl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6639837) has the molecular formula C34H23Cl2FN4O5 and a molecular weight of 657.49 g/mol. Its IUPAC name is (1R,10R,11S,15R)-11,15-dichloro-13-(4-fluorophenyl)-10-(1-hydroxynaphthalen-2-yl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10R,11S,15R)-11,15-dichloro-13-(4-fluorophenyl)-10-(1-hydroxynaphthalen-2-yl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6639837 |
| Molecular Formula | C34H23Cl2FN4O5 |
| Molecular Weight | 657.49 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | (1R,10R,11S,15R)-11,15-dichloro-13-(4-fluorophenyl)-10-(1-hydroxynaphthalen-2-yl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | O=C1N(c2ccc(F)cc2)C(=O)[C@@]2(Cl)[C@@H](c3ccc4ccccc4c3O)C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@@]12Cl |
| InChI | InChI=1S/C34H23Cl2FN4O5/c35-33-18-26-24(16-17-38-31(45)40(32(46)41(26)38)21-7-2-1-3-8-21)27(25-15-10-19-6-4-5-9-23(19)28(25)42)34(33,36)30(44)39(29(33)43)22-13-11-20(37)12-14-22/h1-16,26-27,42H,17-18H2/t26-,27-,33-,34+/m1/s1 |
| InChIKey | ODCYLBLLHCTJMV-ABENWPRUSA-N |
| XLogP | 5.00 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|