C27H23BrCl2N4O6 — CID 3442065
13-(bromomethyl)-11,15-dichloro-10-(3-ethoxy-2-hydroxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 3442065) has the molecular formula C27H23BrCl2N4O6 and a molecular weight of 650.31 g/mol. Its IUPAC name is 13-(bromomethyl)-11,15-dichloro-10-(3-ethoxy-2-hydroxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 13-(bromomethyl)-11,15-dichloro-10-(3-ethoxy-2-hydroxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 3442065 |
| Molecular Formula | C27H23BrCl2N4O6 |
| Molecular Weight | 650.31 g/mol |
| Exact Mass | 648.02 |
| IUPAC Name | 13-(bromomethyl)-11,15-dichloro-10-(3-ethoxy-2-hydroxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | CCOc1cccc(C2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4C3CC3(Cl)C(=O)N(CBr)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C27H23BrCl2N4O6/c1-2-40-19-10-6-9-17(21(19)35)20-16-11-12-32-24(38)33(15-7-4-3-5-8-15)25(39)34(32)18(16)13-26(29)22(36)31(14-28)23(37)27(20,26)30/h3-11,18,20,35H,2,12-14H2,1H3 |
| InChIKey | WOBKGCHKJQNPND-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|