C26H18BrCl2F3N4O6 — CID 4201153
13-(bromomethyl)-11,15-dichloro-10-[2-hydroxy-5-(trifluoromethoxy)phenyl]-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 4201153) has the molecular formula C26H18BrCl2F3N4O6 and a molecular weight of 690.26 g/mol. Its IUPAC name is 13-(bromomethyl)-11,15-dichloro-10-[2-hydroxy-5-(trifluoromethoxy)phenyl]-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 13-(bromomethyl)-11,15-dichloro-10-[2-hydroxy-5-(trifluoromethoxy)phenyl]-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 4201153 |
| Molecular Formula | C26H18BrCl2F3N4O6 |
| Molecular Weight | 690.26 g/mol |
| Exact Mass | 687.97 |
| IUPAC Name | 13-(bromomethyl)-11,15-dichloro-10-[2-hydroxy-5-(trifluoromethoxy)phenyl]-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | O=C1N(CBr)C(=O)C2(Cl)C(c3cc(OC(F)(F)F)ccc3O)C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4C3CC12Cl |
| InChI | InChI=1S/C26H18BrCl2F3N4O6/c27-12-33-20(38)24(28)11-17-15(8-9-34-22(40)35(23(41)36(17)34)13-4-2-1-3-5-13)19(25(24,29)21(33)39)16-10-14(6-7-18(16)37)42-26(30,31)32/h1-8,10,17,19,37H,9,11-12H2 |
| InChIKey | JRUWOEGRTBJLEH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|