C38H28Cl2F3N5O7 — CID 3313707
13-(2,4-dichloroanilino)-10-[2-hydroxy-5-(trifluoromethoxy)phenyl]-11-(4-methoxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 3313707) has the molecular formula C38H28Cl2F3N5O7 and a molecular weight of 794.57 g/mol. Its IUPAC name is 13-(2,4-dichloroanilino)-10-[2-hydroxy-5-(trifluoromethoxy)phenyl]-11-(4-methoxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 13-(2,4-dichloroanilino)-10-[2-hydroxy-5-(trifluoromethoxy)phenyl]-11-(4-methoxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 3313707 |
| Molecular Formula | C38H28Cl2F3N5O7 |
| Molecular Weight | 794.57 g/mol |
| Exact Mass | 793.13 |
| IUPAC Name | 13-(2,4-dichloroanilino)-10-[2-hydroxy-5-(trifluoromethoxy)phenyl]-11-(4-methoxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCn4c(=O)n(-c5ccccc5)c(=O)n42)C3c2cc(OC(F)(F)F)ccc2O)cc1 |
| InChI | InChI=1S/C38H28Cl2F3N5O7/c1-54-23-10-7-20(8-11-23)37-27(33(50)47(34(37)51)44-29-13-9-21(39)17-28(29)40)19-30-25(32(37)26-18-24(12-14-31(26)49)55-38(41,42)43)15-16-45-35(52)46(36(53)48(30)45)22-5-3-2-4-6-22/h2-15,17-18,27,30,32,44,49H,16,19H2,1H3 |
| InChIKey | OJJVIWFXMYMCLF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|