C34H31Cl2N5O7 — CID 6640355
(1R,10R,11S,15R)-13-(2,4-dichloroanilino)-10-(3-ethoxy-2-hydroxyphenyl)-11-(4-methoxyphenyl)-4-methyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6640355) has the molecular formula C34H31Cl2N5O7 and a molecular weight of 692.56 g/mol. Its IUPAC name is (1R,10R,11S,15R)-13-(2,4-dichloroanilino)-10-(3-ethoxy-2-hydroxyphenyl)-11-(4-methoxyphenyl)-4-methyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10R,11S,15R)-13-(2,4-dichloroanilino)-10-(3-ethoxy-2-hydroxyphenyl)-11-(4-methoxyphenyl)-4-methyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6640355 |
| Molecular Formula | C34H31Cl2N5O7 |
| Molecular Weight | 692.56 g/mol |
| Exact Mass | 691.16 |
| IUPAC Name | (1R,10R,11S,15R)-13-(2,4-dichloroanilino)-10-(3-ethoxy-2-hydroxyphenyl)-11-(4-methoxyphenyl)-4-methyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | CCOc1cccc([C@H]2C3=CCn4c(=O)n(C)c(=O)n4[C@@H]3C[C@H]3C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)[C@@]23c2ccc(OC)cc2)c1O |
| InChI | InChI=1S/C34H31Cl2N5O7/c1-4-48-27-7-5-6-22(29(27)42)28-21-14-15-39-32(45)38(2)33(46)41(39)26(21)17-23-30(43)40(37-25-13-10-19(35)16-24(25)36)31(44)34(23,28)18-8-11-20(47-3)12-9-18/h5-14,16,23,26,28,37,42H,4,15,17H2,1-3H3/t23-,26+,28+,34+/m0/s1 |
| InChIKey | SKQCHZGFUSIVFN-LGWNKMRESA-N |
| XLogP | 4.39 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|