C28H21BBrCl2F3N2O8 — CID 5056026
[3-[8-(bromomethyl)-6a,9a-dichloro-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 5056026) has the molecular formula C28H21BBrCl2F3N2O8 and a molecular weight of 732.10 g/mol. Its IUPAC name is [3-[8-(bromomethyl)-6a,9a-dichloro-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[8-(bromomethyl)-6a,9a-dichloro-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 5056026 |
| Molecular Formula | C28H21BBrCl2F3N2O8 |
| Molecular Weight | 732.10 g/mol |
| Exact Mass | 729.99 |
| IUPAC Name | [3-[8-(bromomethyl)-6a,9a-dichloro-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3c3cc(OC(F)(F)F)ccc3O)C2C(=O)N1c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C28H21BBrCl2F3N2O8/c30-11-36-24(41)26(31)10-18-15(21(27(26,32)25(36)42)17-9-14(4-7-19(17)38)45-28(33,34)35)5-6-16-20(18)23(40)37(22(16)39)13-3-1-2-12(8-13)29(43)44/h1-5,7-9,16,18,20-21,38,43-44H,6,10-11H2 |
| InChIKey | OLLUQSZZEUPZRL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.10 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|