C33H22Cl2F4N2O6 — CID 3452524
6a,9a-dichloro-8-(4-fluorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3452524) has the molecular formula C33H22Cl2F4N2O6 and a molecular weight of 689.45 g/mol. Its IUPAC name is 6a,9a-dichloro-8-(4-fluorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3452524 |
| Molecular Formula | C33H22Cl2F4N2O6 |
| Molecular Weight | 689.45 g/mol |
| Exact Mass | 688.08 |
| IUPAC Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2-phenyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3cc(OC(F)(F)F)ccc3O)C2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C33H22Cl2F4N2O6/c34-31-15-23-20(11-12-21-25(23)28(44)40(27(21)43)17-4-2-1-3-5-17)26(22-14-19(10-13-24(22)42)47-33(37,38)39)32(31,35)30(46)41(29(31)45)18-8-6-16(36)7-9-18/h1-11,13-14,21,23,25-26,42H,12,15H2 |
| InChIKey | XGFFDRCCLDKAMJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|