C28H20Cl2F4N2O6 — CID 4599182
6a,9a-dichloro-8-(4-fluorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4599182) has the molecular formula C28H20Cl2F4N2O6 and a molecular weight of 627.37 g/mol. Its IUPAC name is 6a,9a-dichloro-8-(4-fluorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4599182 |
| Molecular Formula | C28H20Cl2F4N2O6 |
| Molecular Weight | 627.37 g/mol |
| Exact Mass | 626.06 |
| IUPAC Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-2-methyl-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3cc(OC(F)(F)F)ccc3O)C2C1=O |
| InChI | InChI=1S/C28H20Cl2F4N2O6/c1-35-22(38)16-8-7-15-18(20(16)23(35)39)11-26(29)24(40)36(13-4-2-12(31)3-5-13)25(41)27(26,30)21(15)17-10-14(6-9-19(17)37)42-28(32,33)34/h2-7,9-10,16,18,20-21,37H,8,11H2,1H3 |
| InChIKey | TYGNRATURRIYCI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|