C29H21Cl2F3N2O9 — CID 3534980
4-[6a,9a-dichloro-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid (PubChem CID 3534980) has the molecular formula C29H21Cl2F3N2O9 and a molecular weight of 669.39 g/mol. Its IUPAC name is 4-[6a,9a-dichloro-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[6a,9a-dichloro-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 3534980 |
| Molecular Formula | C29H21Cl2F3N2O9 |
| Molecular Weight | 669.39 g/mol |
| Exact Mass | 668.06 |
| IUPAC Name | 4-[6a,9a-dichloro-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5ccc(C(=O)O)c(O)c5)C(=O)C43)C(c3cc(OC(F)(F)F)ccc3O)C2(Cl)C1=O |
| InChI | InChI=1S/C29H21Cl2F3N2O9/c1-35-25(43)27(30)10-17-13(21(28(27,31)26(35)44)16-9-12(3-7-18(16)37)45-29(32,33)34)5-6-15-20(17)23(40)36(22(15)39)11-2-4-14(24(41)42)19(38)8-11/h2-5,7-9,15,17,20-21,37-38H,6,10H2,1H3,(H,41,42) |
| InChIKey | WWSOATHVIJZFGC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 161.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|