C28H21BrCl2N2O8 — CID 5054666
4-[6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid (PubChem CID 5054666) has the molecular formula C28H21BrCl2N2O8 and a molecular weight of 664.29 g/mol. Its IUPAC name is 4-[6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 5054666 |
| Molecular Formula | C28H21BrCl2N2O8 |
| Molecular Weight | 664.29 g/mol |
| Exact Mass | 661.99 |
| IUPAC Name | 4-[6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5ccc(C(=O)O)c(O)c5)C(=O)C43)C(c3cc(Br)ccc3O)C2(Cl)C1=O |
| InChI | InChI=1S/C28H21BrCl2N2O8/c1-32-25(40)27(30)10-17-13(21(28(27,31)26(32)41)16-8-11(29)2-7-18(16)34)5-6-15-20(17)23(37)33(22(15)36)12-3-4-14(24(38)39)19(35)9-12/h2-5,7-9,15,17,20-21,34-35H,6,10H2,1H3,(H,38,39) |
| InChIKey | OSBHXVBUDQCHMK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|