C27H20BrCl2N3O7 — CID 3474721
6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3474721) has the molecular formula C27H20BrCl2N3O7 and a molecular weight of 649.28 g/mol. Its IUPAC name is 6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3474721 |
| Molecular Formula | C27H20BrCl2N3O7 |
| Molecular Weight | 649.28 g/mol |
| Exact Mass | 646.99 |
| IUPAC Name | 6-(5-bromo-2-hydroxyphenyl)-6a,9a-dichloro-8-methyl-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5ccc([N+](=O)[O-])cc5)C(=O)C43)C(c3cc(Br)ccc3O)C2(Cl)C1=O |
| InChI | InChI=1S/C27H20BrCl2N3O7/c1-31-24(37)26(29)11-18-15(21(27(26,30)25(31)38)17-10-12(28)2-9-19(17)34)7-8-16-20(18)23(36)32(22(16)35)13-3-5-14(6-4-13)33(39)40/h2-7,9-10,16,18,20-21,34H,8,11H2,1H3 |
| InChIKey | XOJWDPYSVIRTHE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|