C27H20Cl2FN3O7 — CID 4219070
6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(3-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4219070) has the molecular formula C27H20Cl2FN3O7 and a molecular weight of 588.38 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(3-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(3-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4219070 |
| Molecular Formula | C27H20Cl2FN3O7 |
| Molecular Weight | 588.38 g/mol |
| Exact Mass | 587.07 |
| IUPAC Name | 6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(3-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5cccc([N+](=O)[O-])c5)C(=O)C43)C(c3ccc(O)c(F)c3)C2(Cl)C1=O |
| InChI | InChI=1S/C27H20Cl2FN3O7/c1-31-24(37)26(28)11-17-15(21(27(26,29)25(31)38)12-5-8-19(34)18(30)9-12)6-7-16-20(17)23(36)32(22(16)35)13-3-2-4-14(10-13)33(39)40/h2-6,8-10,16-17,20-21,34H,7,11H2,1H3 |
| InChIKey | IMORRFKESJEFBZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|