C34H27Cl2N3O8 — CID 4659746
6a,9a-dichloro-6-(2-hydroxy-4-phenylmethoxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4659746) has the molecular formula C34H27Cl2N3O8 and a molecular weight of 676.51 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(2-hydroxy-4-phenylmethoxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-6-(2-hydroxy-4-phenylmethoxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4659746 |
| Molecular Formula | C34H27Cl2N3O8 |
| Molecular Weight | 676.51 g/mol |
| Exact Mass | 675.12 |
| IUPAC Name | 6a,9a-dichloro-6-(2-hydroxy-4-phenylmethoxyphenyl)-8-methyl-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2(Cl)CC3C(=CCC4C(=O)N(c5ccc([N+](=O)[O-])cc5)C(=O)C43)C(c3ccc(OCc4ccccc4)cc3O)C2(Cl)C1=O |
| InChI | InChI=1S/C34H27Cl2N3O8/c1-37-31(43)33(35)16-25-22(13-14-24-27(25)30(42)38(29(24)41)19-7-9-20(10-8-19)39(45)46)28(34(33,36)32(37)44)23-12-11-21(15-26(23)40)47-17-18-5-3-2-4-6-18/h2-13,15,24-25,27-28,40H,14,16-17H2,1H3 |
| InChIKey | ONUIJMFWDYGYJH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|