C47H36N2O8 — CID 3627159
6-(2-hydroxy-4-phenylmethoxyphenyl)-2-(4-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3627159) has the molecular formula C47H36N2O8 and a molecular weight of 756.81 g/mol. Its IUPAC name is 6-(2-hydroxy-4-phenylmethoxyphenyl)-2-(4-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(2-hydroxy-4-phenylmethoxyphenyl)-2-(4-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3627159 |
| Molecular Formula | C47H36N2O8 |
| Molecular Weight | 756.81 g/mol |
| Exact Mass | 756.25 |
| IUPAC Name | 6-(2-hydroxy-4-phenylmethoxyphenyl)-2-(4-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)C2(c3ccccc3)C1CC1C(=CCC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C31)C2c1ccc(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C47H36N2O8/c50-40-24-33(57-27-28-10-4-1-5-11-28)20-21-35(40)43-34-22-23-36-42(46(54)48(45(36)53)31-16-18-32(19-17-31)49(55)56)38(34)25-39-44(52)37(29-12-6-2-7-13-29)26-41(51)47(39,43)30-14-8-3-9-15-30/h1-22,24,26,36,38-39,42-43,50H,23,25,27H2 |
| InChIKey | NAMMVJQDIYZLCU-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.81 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|