C40H29ClN2O7 — CID 3551579
6-(2-chloro-4-hydroxyphenyl)-2-(4-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3551579) has the molecular formula C40H29ClN2O7 and a molecular weight of 685.13 g/mol. Its IUPAC name is 6-(2-chloro-4-hydroxyphenyl)-2-(4-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(2-chloro-4-hydroxyphenyl)-2-(4-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3551579 |
| Molecular Formula | C40H29ClN2O7 |
| Molecular Weight | 685.13 g/mol |
| Exact Mass | 684.17 |
| IUPAC Name | 6-(2-chloro-4-hydroxyphenyl)-2-(4-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)C2(c3ccccc3)C1CC1C(=CCC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C31)C2c1ccc(O)cc1Cl |
| InChI | InChI=1S/C40H29ClN2O7/c41-33-19-26(44)15-16-28(33)36-27-17-18-29-35(39(48)42(38(29)47)24-11-13-25(14-12-24)43(49)50)31(27)20-32-37(46)30(22-7-3-1-4-8-22)21-34(45)40(32,36)23-9-5-2-6-10-23/h1-17,19,21,29,31-32,35-36,44H,18,20H2 |
| InChIKey | BUVCAACVUONXFC-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.13 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|