C40H30BrNO5 — CID 5160437
6-(5-bromo-2-hydroxyphenyl)-2,6a,9-triphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5160437) has the molecular formula C40H30BrNO5 and a molecular weight of 684.59 g/mol. Its IUPAC name is 6-(5-bromo-2-hydroxyphenyl)-2,6a,9-triphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(5-bromo-2-hydroxyphenyl)-2,6a,9-triphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5160437 |
| Molecular Formula | C40H30BrNO5 |
| Molecular Weight | 684.59 g/mol |
| Exact Mass | 683.13 |
| IUPAC Name | 6-(5-bromo-2-hydroxyphenyl)-2,6a,9-triphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)C2(c3ccccc3)C1CC1C(=CCC3C(=O)N(c4ccccc4)C(=O)C31)C2c1cc(Br)ccc1O |
| InChI | InChI=1S/C40H30BrNO5/c41-25-16-19-33(43)31(20-25)36-27-17-18-28-35(39(47)42(38(28)46)26-14-8-3-9-15-26)30(27)21-32-37(45)29(23-10-4-1-5-11-23)22-34(44)40(32,36)24-12-6-2-7-13-24/h1-17,19-20,22,28,30,32,35-36,43H,18,21H2 |
| InChIKey | AYTQXZOMTKAVHI-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.59 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|