C40H32BNO7 — CID 6660301
[3-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 6660301) has the molecular formula C40H32BNO7 and a molecular weight of 649.51 g/mol. Its IUPAC name is [3-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 6660301 |
| Molecular Formula | C40H32BNO7 |
| Molecular Weight | 649.51 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | [3-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | O=C1C(c2ccccc2)=CC(=O)[C@@]2(c3ccccc3)[C@@H](c3ccccc3O)C3=CC[C@@H]4C(=O)N(c5cccc(B(O)O)c5)C(=O)[C@@H]4[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C40H32BNO7/c43-33-17-8-7-16-28(33)36-27-18-19-29-35(39(47)42(38(29)46)26-15-9-14-25(20-26)41(48)49)31(27)21-32-37(45)30(23-10-3-1-4-11-23)22-34(44)40(32,36)24-12-5-2-6-13-24/h1-18,20,22,29,31-32,35-36,43,48-49H,19,21H2/t29-,31+,32-,35-,36+,40-/m0/s1 |
| InChIKey | UGINUIBXRZOZSR-KNZCNGMASA-N |
| XLogP | 4.10 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|