C42H36BNO7 — CID 3486828
[3-[6-(4-hydroxy-3,5-dimethylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 3486828) has the molecular formula C42H36BNO7 and a molecular weight of 677.56 g/mol. Its IUPAC name is [3-[6-(4-hydroxy-3,5-dimethylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[6-(4-hydroxy-3,5-dimethylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 3486828 |
| Molecular Formula | C42H36BNO7 |
| Molecular Weight | 677.56 g/mol |
| Exact Mass | 677.26 |
| IUPAC Name | [3-[6-(4-hydroxy-3,5-dimethylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | Cc1cc(C2C3=CCC4C(=O)N(c5cccc(B(O)O)c5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)cc(C)c1O |
| InChI | InChI=1S/C42H36BNO7/c1-23-18-26(19-24(2)38(23)46)37-30-16-17-31-36(41(49)44(40(31)48)29-15-9-14-28(20-29)43(50)51)33(30)21-34-39(47)32(25-10-5-3-6-11-25)22-35(45)42(34,37)27-12-7-4-8-13-27/h3-16,18-20,22,31,33-34,36-37,46,50-51H,17,21H2,1-2H3 |
| InChIKey | XRZXTBXIDQSHMR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|