C40H30FNO5 — CID 6660955
(3aS,6R,6aS,10aR,11aS,11bR)-6-(3-fluoro-4-hydroxyphenyl)-2,6a,9-triphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6660955) has the molecular formula C40H30FNO5 and a molecular weight of 623.68 g/mol. Its IUPAC name is (3aS,6R,6aS,10aR,11aS,11bR)-6-(3-fluoro-4-hydroxyphenyl)-2,6a,9-triphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,6aS,10aR,11aS,11bR)-6-(3-fluoro-4-hydroxyphenyl)-2,6a,9-triphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6660955 |
| Molecular Formula | C40H30FNO5 |
| Molecular Weight | 623.68 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | (3aS,6R,6aS,10aR,11aS,11bR)-6-(3-fluoro-4-hydroxyphenyl)-2,6a,9-triphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)[C@@]2(c3ccccc3)[C@@H](c3ccc(O)c(F)c3)C3=CC[C@@H]4C(=O)N(c5ccccc5)C(=O)[C@@H]4[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C40H30FNO5/c41-32-20-24(16-19-33(32)43)36-27-17-18-28-35(39(47)42(38(28)46)26-14-8-3-9-15-26)30(27)21-31-37(45)29(23-10-4-1-5-11-23)22-34(44)40(31,36)25-12-6-2-7-13-25/h1-17,19-20,22,28,30-31,35-36,43H,18,21H2/t28-,30+,31-,35-,36-,40-/m0/s1 |
| InChIKey | HFSBLWGIAOIDLS-PLHNZGBSSA-N |
| XLogP | 6.56 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.68 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|