C43H35NO6 — CID 6661046
(3aS,6R,6aS,10aR,11aS,11bR)-2-(4-acetylphenyl)-6-(4-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6661046) has the molecular formula C43H35NO6 and a molecular weight of 661.75 g/mol. Its IUPAC name is (3aS,6R,6aS,10aR,11aS,11bR)-2-(4-acetylphenyl)-6-(4-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-(4-acetylphenyl)-6-(4-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6661046 |
| Molecular Formula | C43H35NO6 |
| Molecular Weight | 661.75 g/mol |
| Exact Mass | 661.25 |
| IUPAC Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-(4-acetylphenyl)-6-(4-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@H]3[C@H](CC=C4[C@H]3C[C@H]3C(=O)C(c5ccccc5)=CC(=O)[C@@]3(c3ccccc3)[C@H]4c3ccc(O)c(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C43H35NO6/c1-24-21-28(15-20-36(24)46)39-31-18-19-32-38(42(50)44(41(32)49)30-16-13-26(14-17-30)25(2)45)34(31)22-35-40(48)33(27-9-5-3-6-10-27)23-37(47)43(35,39)29-11-7-4-8-12-29/h3-18,20-21,23,32,34-35,38-39,46H,19,22H2,1-2H3/t32-,34+,35-,38-,39-,43-/m0/s1 |
| InChIKey | PIJCEEUAYJVNHC-ZNHXVDINSA-N |
| XLogP | 6.93 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.75 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|