C42H28F7NO5 — CID 5139652
2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-fluoro-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5139652) has the molecular formula C42H28F7NO5 and a molecular weight of 759.67 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-fluoro-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-fluoro-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5139652 |
| Molecular Formula | C42H28F7NO5 |
| Molecular Weight | 759.67 g/mol |
| Exact Mass | 759.19 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-fluoro-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)C2(c3ccccc3)C1CC1C(=CCC3C(=O)N(c4cc(C(F)(F)F)cc(C(F)(F)F)c4)C(=O)C31)C2c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C42H28F7NO5/c43-32-15-22(11-14-33(32)51)36-27-12-13-28-35(39(55)50(38(28)54)26-17-24(41(44,45)46)16-25(18-26)42(47,48)49)30(27)19-31-37(53)29(21-7-3-1-4-8-21)20-34(52)40(31,36)23-9-5-2-6-10-23/h1-12,14-18,20,28,30-31,35-36,51H,13,19H2 |
| InChIKey | FDOQLZREKWOMOF-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.67 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|