C42H32FNO5 — CID 3401081
2-(4-ethenylphenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3401081) has the molecular formula C42H32FNO5 and a molecular weight of 649.72 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-ethenylphenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3401081 |
| Molecular Formula | C42H32FNO5 |
| Molecular Weight | 649.72 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | 2-(4-ethenylphenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)C3CC=C4C(CC5C(=O)C(c6ccccc6)=CC(=O)C5(c5ccccc5)C4c4ccc(O)c(F)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C42H32FNO5/c1-2-24-13-16-28(17-14-24)44-40(48)30-19-18-29-32(37(30)41(44)49)22-33-39(47)31(25-9-5-3-6-10-25)23-36(46)42(33,27-11-7-4-8-12-27)38(29)26-15-20-35(45)34(43)21-26/h2-18,20-21,23,30,32-33,37-38,45H,1,19,22H2 |
| InChIKey | OGURPJWEYHHPBC-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.72 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|