C41H34BNO7 — CID 5065120
[3-[6-(2-hydroxy-3-methylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 5065120) has the molecular formula C41H34BNO7 and a molecular weight of 663.54 g/mol. Its IUPAC name is [3-[6-(2-hydroxy-3-methylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[6-(2-hydroxy-3-methylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 5065120 |
| Molecular Formula | C41H34BNO7 |
| Molecular Weight | 663.54 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | [3-[6-(2-hydroxy-3-methylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | Cc1cccc(C2C3=CCC4C(=O)N(c5cccc(B(O)O)c5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)c1O |
| InChI | InChI=1S/C41H34BNO7/c1-23-10-8-17-30(37(23)45)36-28-18-19-29-35(40(48)43(39(29)47)27-16-9-15-26(20-27)42(49)50)32(28)21-33-38(46)31(24-11-4-2-5-12-24)22-34(44)41(33,36)25-13-6-3-7-14-25/h2-18,20,22,29,32-33,35-36,45,49-50H,19,21H2,1H3 |
| InChIKey | MTQRBIYYKRBMST-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|