C51H43NO7 — CID 4200876
2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4200876) has the molecular formula C51H43NO7 and a molecular weight of 781.91 g/mol. Its IUPAC name is 2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4200876 |
| Molecular Formula | C51H43NO7 |
| Molecular Weight | 781.91 g/mol |
| Exact Mass | 781.30 |
| IUPAC Name | 2-[4-[2-(2,5-dimethoxyphenyl)ethenyl]phenyl]-6-(2-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(OC)c(C=Cc2ccc(N3C(=O)C4CC=C5C(CC6C(=O)C(c7ccccc7)=CC(=O)C6(c6ccccc6)C5c5cccc(C)c5O)C4C3=O)cc2)c1 |
| InChI | InChI=1S/C51H43NO7/c1-30-11-10-16-39(47(30)54)46-37-24-25-38-45(50(57)52(49(38)56)35-21-18-31(19-22-35)17-20-33-27-36(58-2)23-26-43(33)59-3)41(37)28-42-48(55)40(32-12-6-4-7-13-32)29-44(53)51(42,46)34-14-8-5-9-15-34/h4-24,26-27,29,38,41-42,45-46,54H,25,28H2,1-3H3 |
| InChIKey | QZESYOZDFUUDIU-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.91 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|