C41H32INO6 — CID 5155140
6-(4-hydroxy-2-methoxyphenyl)-2-(4-iodophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5155140) has the molecular formula C41H32INO6 and a molecular weight of 761.61 g/mol. Its IUPAC name is 6-(4-hydroxy-2-methoxyphenyl)-2-(4-iodophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(4-hydroxy-2-methoxyphenyl)-2-(4-iodophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5155140 |
| Molecular Formula | C41H32INO6 |
| Molecular Weight | 761.61 g/mol |
| Exact Mass | 761.13 |
| IUPAC Name | 6-(4-hydroxy-2-methoxyphenyl)-2-(4-iodophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)ccc1C1C2=CCC3C(=O)N(c4ccc(I)cc4)C(=O)C3C2CC2C(=O)C(c3ccccc3)=CC(=O)C21c1ccccc1 |
| InChI | InChI=1S/C41H32INO6/c1-49-34-20-27(44)16-17-29(34)37-28-18-19-30-36(40(48)43(39(30)47)26-14-12-25(42)13-15-26)32(28)21-33-38(46)31(23-8-4-2-5-9-23)22-35(45)41(33,37)24-10-6-3-7-11-24/h2-18,20,22,30,32-33,36-37,44H,19,21H2,1H3 |
| InChIKey | IGAJBGLDQCGQDH-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.61 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|