C43H36ClNO7 — CID 4051760
2-(3-chloro-4-methylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4051760) has the molecular formula C43H36ClNO7 and a molecular weight of 714.21 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(3-chloro-4-methylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4051760 |
| Molecular Formula | C43H36ClNO7 |
| Molecular Weight | 714.21 g/mol |
| Exact Mass | 713.22 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(c4ccc(C)c(Cl)c4)C(=O)C3C2CC2C(=O)C(c3ccccc3)=CC(=O)C21c1ccccc1 |
| InChI | InChI=1S/C43H36ClNO7/c1-23-14-15-26(18-33(23)44)45-41(49)29-17-16-28-31(37(29)42(45)50)21-32-40(48)30(24-10-6-4-7-11-24)22-36(47)43(32,25-12-8-5-9-13-25)39(28)38-34(51-2)19-27(46)20-35(38)52-3/h4-16,18-20,22,29,31-32,37,39,46H,17,21H2,1-3H3 |
| InChIKey | BBUBOSYBAHLBMH-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.21 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|