C43H35NO9 — CID 5056142
3-[6-(4-hydroxy-2,6-dimethoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid (PubChem CID 5056142) has the molecular formula C43H35NO9 and a molecular weight of 709.75 g/mol. Its IUPAC name is 3-[6-(4-hydroxy-2,6-dimethoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6-(4-hydroxy-2,6-dimethoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 5056142 |
| Molecular Formula | C43H35NO9 |
| Molecular Weight | 709.75 g/mol |
| Exact Mass | 709.23 |
| IUPAC Name | 3-[6-(4-hydroxy-2,6-dimethoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(c4cccc(C(=O)O)c4)C(=O)C3C2CC2C(=O)C(c3ccccc3)=CC(=O)C21c1ccccc1 |
| InChI | InChI=1S/C43H35NO9/c1-52-33-19-27(45)20-34(53-2)37(33)38-28-16-17-29-36(41(49)44(40(29)48)26-15-9-12-24(18-26)42(50)51)31(28)21-32-39(47)30(23-10-5-3-6-11-23)22-35(46)43(32,38)25-13-7-4-8-14-25/h3-16,18-20,22,29,31-32,36,38,45H,17,21H2,1-2H3,(H,50,51) |
| InChIKey | PWRCLYUUWVVEFW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.75 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|