C41H30BrNO7 — CID 5086772
3-[6-(5-bromo-2-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid (PubChem CID 5086772) has the molecular formula C41H30BrNO7 and a molecular weight of 728.60 g/mol. Its IUPAC name is 3-[6-(5-bromo-2-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6-(5-bromo-2-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 5086772 |
| Molecular Formula | C41H30BrNO7 |
| Molecular Weight | 728.60 g/mol |
| Exact Mass | 727.12 |
| IUPAC Name | 3-[6-(5-bromo-2-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)C3CC=C4C(CC5C(=O)C(c6ccccc6)=CC(=O)C5(c5ccccc5)C4c4cc(Br)ccc4O)C3C2=O)c1 |
| InChI | InChI=1S/C41H30BrNO7/c42-25-14-17-33(44)31(19-25)36-27-15-16-28-35(39(48)43(38(28)47)26-13-7-10-23(18-26)40(49)50)30(27)20-32-37(46)29(22-8-3-1-4-9-22)21-34(45)41(32,36)24-11-5-2-6-12-24/h1-15,17-19,21,28,30,32,35-36,44H,16,20H2,(H,49,50) |
| InChIKey | OEMKFGQRQKICMT-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|