C48H34F3NO7 — CID 5085279
2-(4-benzoylphenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5085279) has the molecular formula C48H34F3NO7 and a molecular weight of 793.79 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-benzoylphenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5085279 |
| Molecular Formula | C48H34F3NO7 |
| Molecular Weight | 793.79 g/mol |
| Exact Mass | 793.23 |
| IUPAC Name | 2-(4-benzoylphenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C(c1ccccc1)c1ccc(N2C(=O)C3CC=C4C(CC5C(=O)C(c6ccccc6)=CC(=O)C5(c5ccccc5)C4c4cc(OC(F)(F)F)ccc4O)C3C2=O)cc1 |
| InChI | InChI=1S/C48H34F3NO7/c49-48(50,51)59-32-20-23-39(53)37(24-32)42-33-21-22-34-41(46(58)52(45(34)57)31-18-16-29(17-19-31)43(55)28-12-6-2-7-13-28)36(33)25-38-44(56)35(27-10-4-1-5-11-27)26-40(54)47(38,42)30-14-8-3-9-15-30/h1-21,23-24,26,34,36,38,41-42,53H,22,25H2 |
| InChIKey | FDCJIJISGKFHKQ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.79 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|