C46H41BrN2O5 — CID 4160777
2-(1-benzylpiperidin-4-yl)-6-(5-bromo-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4160777) has the molecular formula C46H41BrN2O5 and a molecular weight of 781.75 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-6-(5-bromo-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-6-(5-bromo-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4160777 |
| Molecular Formula | C46H41BrN2O5 |
| Molecular Weight | 781.75 g/mol |
| Exact Mass | 780.22 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-6-(5-bromo-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)C2(c3ccccc3)C1CC1C(=CCC3C(=O)N(C4CCN(Cc5ccccc5)CC4)C(=O)C31)C2c1cc(Br)ccc1O |
| InChI | InChI=1S/C46H41BrN2O5/c47-31-16-19-39(50)37(24-31)42-33-17-18-34-41(45(54)49(44(34)53)32-20-22-48(23-21-32)27-28-10-4-1-5-11-28)36(33)25-38-43(52)35(29-12-6-2-7-13-29)26-40(51)46(38,42)30-14-8-3-9-15-30/h1-17,19,24,26,32,34,36,38,41-42,50H,18,20-23,25,27H2 |
| InChIKey | XVLRBHRVUFYWOG-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.75 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|