C49H44N2O6 — CID 4177855
2-(1-benzylpiperidin-4-yl)-6-(6-hydroxy-4H-chromen-3-yl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4177855) has the molecular formula C49H44N2O6 and a molecular weight of 756.90 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-6-(6-hydroxy-4H-chromen-3-yl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-6-(6-hydroxy-4H-chromen-3-yl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4177855 |
| Molecular Formula | C49H44N2O6 |
| Molecular Weight | 756.90 g/mol |
| Exact Mass | 756.32 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-6-(6-hydroxy-4H-chromen-3-yl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)C2(c3ccccc3)C1CC1C(=CCC3C(=O)N(C4CCN(Cc5ccccc5)CC4)C(=O)C31)C2C1=COc2ccc(O)cc2C1 |
| InChI | InChI=1S/C49H44N2O6/c52-36-16-19-42-32(25-36)24-33(29-57-42)45-37-17-18-38-44(48(56)51(47(38)55)35-20-22-50(23-21-35)28-30-10-4-1-5-11-30)40(37)26-41-46(54)39(31-12-6-2-7-13-31)27-43(53)49(41,45)34-14-8-3-9-15-34/h1-17,19,25,27,29,35,38,40-41,44-45,52H,18,20-24,26,28H2 |
| InChIKey | TVLHFSNHFYICKO-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.90 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|