C41H37Br2NO6 — CID 4104198
2-cyclohexyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4104198) has the molecular formula C41H37Br2NO6 and a molecular weight of 799.56 g/mol. Its IUPAC name is 2-cyclohexyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-cyclohexyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4104198 |
| Molecular Formula | C41H37Br2NO6 |
| Molecular Weight | 799.56 g/mol |
| Exact Mass | 797.10 |
| IUPAC Name | 2-cyclohexyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(C5CCCCC5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C41H37Br2NO6/c1-50-31-20-29(35(42)36(43)38(31)47)34-25-17-18-26-33(40(49)44(39(26)48)24-15-9-4-10-16-24)28(25)19-30-37(46)27(22-11-5-2-6-12-22)21-32(45)41(30,34)23-13-7-3-8-14-23/h2-3,5-8,11-14,17,20-21,24,26,28,30,33-34,47H,4,9-10,15-16,18-19H2,1H3 |
| InChIKey | MRQAAGCZIRQUTG-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.56 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|