C54H40N2O7 — CID 4296539
2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(2-hydroxy-4-phenylmethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4296539) has the molecular formula C54H40N2O7 and a molecular weight of 828.92 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(2-hydroxy-4-phenylmethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(2-hydroxy-4-phenylmethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4296539 |
| Molecular Formula | C54H40N2O7 |
| Molecular Weight | 828.92 g/mol |
| Exact Mass | 828.28 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-6-(2-hydroxy-4-phenylmethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)C2(c3ccccc3)C1CC1C(=CCC3C(=O)N(c4ccc(-c5nc6ccccc6o5)cc4)C(=O)C31)C2c1ccc(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C54H40N2O7/c57-45-28-37(62-31-32-12-4-1-5-13-32)24-25-39(45)49-38-26-27-40-48(53(61)56(52(40)60)36-22-20-34(21-23-36)51-55-44-18-10-11-19-46(44)63-51)42(38)29-43-50(59)41(33-14-6-2-7-15-33)30-47(58)54(43,49)35-16-8-3-9-17-35/h1-26,28,30,40,42-43,48-49,57H,27,29,31H2 |
| InChIKey | OPNNCMTXWNPMJZ-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.92 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|