C36H31BrCl2N2O6 — CID 4174628
8-(bromomethyl)-6a,9a-dichloro-2-(4-ethylphenyl)-6-(2-hydroxy-4-phenylmethoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4174628) has the molecular formula C36H31BrCl2N2O6 and a molecular weight of 738.46 g/mol. Its IUPAC name is 8-(bromomethyl)-6a,9a-dichloro-2-(4-ethylphenyl)-6-(2-hydroxy-4-phenylmethoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-6a,9a-dichloro-2-(4-ethylphenyl)-6-(2-hydroxy-4-phenylmethoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4174628 |
| Molecular Formula | C36H31BrCl2N2O6 |
| Molecular Weight | 738.46 g/mol |
| Exact Mass | 736.07 |
| IUPAC Name | 8-(bromomethyl)-6a,9a-dichloro-2-(4-ethylphenyl)-6-(2-hydroxy-4-phenylmethoxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCc1ccc(N2C(=O)C3CC=C4C(CC5(Cl)C(=O)N(CBr)C(=O)C5(Cl)C4c4ccc(OCc5ccccc5)cc4O)C3C2=O)cc1 |
| InChI | InChI=1S/C36H31BrCl2N2O6/c1-2-20-8-10-22(11-9-20)41-31(43)26-15-14-24-27(29(26)32(41)44)17-35(38)33(45)40(19-37)34(46)36(35,39)30(24)25-13-12-23(16-28(25)42)47-18-21-6-4-3-5-7-21/h3-14,16,26-27,29-30,42H,2,15,17-19H2,1H3 |
| InChIKey | ASGZRBCRLMEOCZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|