C29H25BrCl2N2O5 — CID 3496612
8-(bromomethyl)-6a,9a-dichloro-2-(4-ethylphenyl)-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3496612) has the molecular formula C29H25BrCl2N2O5 and a molecular weight of 632.34 g/mol. Its IUPAC name is 8-(bromomethyl)-6a,9a-dichloro-2-(4-ethylphenyl)-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-6a,9a-dichloro-2-(4-ethylphenyl)-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3496612 |
| Molecular Formula | C29H25BrCl2N2O5 |
| Molecular Weight | 632.34 g/mol |
| Exact Mass | 630.03 |
| IUPAC Name | 8-(bromomethyl)-6a,9a-dichloro-2-(4-ethylphenyl)-6-(3-hydroxyphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCc1ccc(N2C(=O)C3CC=C4C(CC5(Cl)C(=O)N(CBr)C(=O)C5(Cl)C4c4cccc(O)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C29H25BrCl2N2O5/c1-2-15-6-8-17(9-7-15)34-24(36)20-11-10-19-21(22(20)25(34)37)13-28(31)26(38)33(14-30)27(39)29(28,32)23(19)16-4-3-5-18(35)12-16/h3-10,12,20-23,35H,2,11,13-14H2,1H3 |
| InChIKey | DXMCELKVVRXOBY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.34 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|