C21H19BrCl2N4O5 — CID 4116330
13-(bromomethyl)-11,15-dichloro-10-(2-hydroxy-3-methylphenyl)-4-methyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 4116330) has the molecular formula C21H19BrCl2N4O5 and a molecular weight of 558.22 g/mol. Its IUPAC name is 13-(bromomethyl)-11,15-dichloro-10-(2-hydroxy-3-methylphenyl)-4-methyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 13-(bromomethyl)-11,15-dichloro-10-(2-hydroxy-3-methylphenyl)-4-methyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 4116330 |
| Molecular Formula | C21H19BrCl2N4O5 |
| Molecular Weight | 558.22 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | 13-(bromomethyl)-11,15-dichloro-10-(2-hydroxy-3-methylphenyl)-4-methyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | Cc1cccc(C2C3=CCn4c(=O)n(C)c(=O)n4C3CC3(Cl)C(=O)N(CBr)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C21H19BrCl2N4O5/c1-10-4-3-5-12(15(10)29)14-11-6-7-27-18(32)25(2)19(33)28(27)13(11)8-20(23)16(30)26(9-22)17(31)21(14,20)24/h3-6,13-14,29H,7-9H2,1-2H3 |
| InChIKey | MLWWLQCDBTURKS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|