C30H25BrCl2N2O6 — CID 3460158
2-(4-acetylphenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3460158) has the molecular formula C30H25BrCl2N2O6 and a molecular weight of 660.35 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-acetylphenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3460158 |
| Molecular Formula | C30H25BrCl2N2O6 |
| Molecular Weight | 660.35 g/mol |
| Exact Mass | 658.03 |
| IUPAC Name | 2-(4-acetylphenyl)-8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC(=O)c1ccc(N2C(=O)C3CC=C4C(CC5(Cl)C(=O)N(CBr)C(=O)C5(Cl)C4c4cccc(C)c4O)C3C2=O)cc1 |
| InChI | InChI=1S/C30H25BrCl2N2O6/c1-14-4-3-5-20(24(14)37)23-18-10-11-19-22(21(18)12-29(32)27(40)34(13-31)28(41)30(23,29)33)26(39)35(25(19)38)17-8-6-16(7-9-17)15(2)36/h3-10,19,21-23,37H,11-13H2,1-2H3 |
| InChIKey | OIADNBJBMZZTPV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|