C32H30BrCl2N3O6 — CID 4581470
8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4581470) has the molecular formula C32H30BrCl2N3O6 and a molecular weight of 703.42 g/mol. Its IUPAC name is 8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4581470 |
| Molecular Formula | C32H30BrCl2N3O6 |
| Molecular Weight | 703.42 g/mol |
| Exact Mass | 701.07 |
| IUPAC Name | 8-(bromomethyl)-6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-2-(4-morpholin-4-ylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cccc(C2C3=CCC4C(=O)N(c5ccc(N6CCOCC6)cc5)C(=O)C4C3CC3(Cl)C(=O)N(CBr)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C32H30BrCl2N3O6/c1-17-3-2-4-22(26(17)39)25-20-9-10-21-24(23(20)15-31(34)29(42)37(16-33)30(43)32(25,31)35)28(41)38(27(21)40)19-7-5-18(6-8-19)36-11-13-44-14-12-36/h2-9,21,23-25,39H,10-16H2,1H3 |
| InChIKey | DXPZESHEQYHREJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|