C21H20Cl2N4O6 — CID 6639737
(1R,10S,11S,15R)-11,15-dichloro-10-(4-hydroxy-3-methoxyphenyl)-4,13-dimethyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6639737) has the molecular formula C21H20Cl2N4O6 and a molecular weight of 495.32 g/mol. Its IUPAC name is (1R,10S,11S,15R)-11,15-dichloro-10-(4-hydroxy-3-methoxyphenyl)-4,13-dimethyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10S,11S,15R)-11,15-dichloro-10-(4-hydroxy-3-methoxyphenyl)-4,13-dimethyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6639737 |
| Molecular Formula | C21H20Cl2N4O6 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (1R,10S,11S,15R)-11,15-dichloro-10-(4-hydroxy-3-methoxyphenyl)-4,13-dimethyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | COc1cc([C@H]2C3=CCn4c(=O)n(C)c(=O)n4[C@@H]3C[C@@]3(Cl)C(=O)N(C)C(=O)[C@@]23Cl)ccc1O |
| InChI | InChI=1S/C21H20Cl2N4O6/c1-24-16(29)20(22)9-12-11(6-7-26-18(31)25(2)19(32)27(12)26)15(21(20,23)17(24)30)10-4-5-13(28)14(8-10)33-3/h4-6,8,12,15,28H,7,9H2,1-3H3/t12-,15+,20-,21+/m1/s1 |
| InChIKey | YZHBYVTXAKTWQU-JVPLYVEPSA-N |
| XLogP | 0.69 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|